| Identification | |
| Name: | Ethanol,2,2'-[(9Z)-9-octadecen-1-ylimino]bis- |
| Synonyms: | Ethanol,2,2'-(9-octadecenylimino)bis-, (Z)-;Ethanol, 2,2'-(9-octadecenylimino)di-,(Z)- (8CI);Ethanol, 2,2'-[(9Z)-9-octadecenylimino]bis- (9CI);2,2'-(Oleylamino)diethanol;Anstex SA 35;Armostat 710;N,N-Bis(2-hydroxyethyl)oleylamine;N,N-Bis(hydroxyethyl)oleylamine;N-Oleyldiethanolamine;Oleylbis(2-hydroxyethyl)amine; |
| CAS: | 13127-82-7 |
| EINECS: | 236-062-2 |
| Molecular Formula: | C22H45NO2 |
| Molecular Weight: | 355.603 |
| InChI: | InChI=1/C22H45NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(19-21-24)20-22-25/h9-10,24-25H,2-8,11-22H2,1H3/b10-9- |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 202.6°C |
| Boiling Point: | 480.5°Cat760mmHg |
| Density: | 0.917g/cm3 |
| Refractive index: | 1.483 |
| Specification: |
The Ethanol,2,2'-[(9Z)-9-octadecen-1-ylimino]bis-, with the CAS registry number 13127-82-7, has the IUPAC name of 2-[2-hydroxyethyl-[(Z)-octadec-9-enyl]amino]ethanol. The physical properties of this chemical are as below: (1)ACD/LogP: 7.80; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 5.01; (4)ACD/LogD (pH 7.4): 6.59; (5)ACD/BCF (pH 5.5): 805.65 ; (6)ACD/BCF (pH 7.4): 31089.16; (7)ACD/KOC (pH 5.5): 674.59; (8)ACD/KOC (pH 7.4): 26031.7; (9)#H bond acceptors: 3; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 22; (12)Polar Surface Area: 21.7; (13)Index of Refraction: 1.483; (14)Molar Refractivity: 110.82 cm3; (15)Molar Volume: 387.5 cm3; (16)Polarizability: 43.93×10-24 cm3; (17)Surface Tension: 36.6 dyne/cm; (18)Density: 0.917 g/cm3; (19)Flash Point: 202.6 °C; (20)Enthalpy of Vaporization: 85.86 kJ/mol; (21)Boiling Point: 480.5 °C at 760 mmHg; (22)Vapour Pressure: 3E-11 mmHg at 25°C. In addition, you could obtain the molecular structure by using the following datas: |
| Flash Point: | 202.6°C |
| Safety Data | |
 |
|
