| Identification | |
| Name: | Lead(II,IV) oxide |
| Synonyms: | Trilead tetroxide; Lead oxide red; Red lead; lead tetroxide; granulated lead red; red lead oxide powder; granulated lead tetroxide; lead red granular |
| CAS: | 1314-41-6 |
| EINECS: | 215-235-6 |
| Molecular Formula: | Pb3O4 |
| Molecular Weight: | 685.6 |
| InChI: | InChI=1/4O.3Pb/rO4Pb3/c1-5-2-7-3-6(1)4-7 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1479 |
| Boiling Point: | 800 oC |
| Density: | 9.1 |
| Stability: | Stable. May react vigorously with reducing agents. |
| Solubility: | Insol in alcohol; sol in acetic acid, dil nitric acid, warm soln of fixed alkali hydroxides Sol in ammonium chloride In water: 0.0504 g/L at 25 deg C (alpha form); 0.1065 g/L at 25 deg C (beta form) Water: 0.017 g/L at 20 deg C |
| Appearance: | red powder |
| Packinggroup: | O52 |
| Color: | Exists in 2 forms: red to reddish-yellow, tetragonal crystals & yellow, orthorhombic crystals |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
