| Identification | |
| Name: | 1H-Pyrrole-2,5-dione,1-(2,4,6-trichlorophenyl)- |
| Synonyms: | Maleimide,N-(2,4,6-trichlorophenyl)- (6CI);2,4,6-Trichlorophenylmaleimide;1-(2,4,6-Trichlorophenyl)-1H-pyrrole-2,5-dione;AC1L34X2;AC1Q3L3F; |
| CAS: | 13167-25-4 |
| EINECS: | 236-108-1 |
| Molecular Formula: | C10H4Cl3NO2 |
| Molecular Weight: | 276.5 |
| InChI: | InChI=1/C10H4Cl3NO2/c11-5-3-6(12)10(7(13)4-5)14-8(15)1-2-9(14)16/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 134 °C |
| Density: | 1.664 g/cm3 |
| Refractive index: | 1.655 |
| Appearance: | White to Slight yellow Crystal |
| Specification: |
1H-Pyrrole-2,5-dione,1-(2,4,6-trichlorophenyl)- , its cas register number 13167-25-4. It also can be called 1-(2,4,6-Trichlorophenyl)-1H-pyrrole-2,5-dione ; and N-(2,4,6-Trichlorophenyl)maleimide . |
| Safety Data | |
 |
|
