| Identification |
| Name: | Acetic acid,2-(5,7,8,9-tetrahydro-5-hydroxy-6H-benzocyclohepten-6-ylidene)-, sodium salt(1:1) |
| Synonyms: | Aceticacid, (5,7,8,9-tetrahydro-5-hydroxy-6H-benzocyclohepten-6-ylidene)-, monosodiumsalt (9CI) |
| CAS: | 131733-92-1 |
| Molecular Formula: | C13H14 O3 . Na |
| Molecular Weight: | 240.23 |
| InChI: | InChI=1/C13H14O3.Na/c14-12(15)8-10-6-3-5-9-4-1-2-7-11(9)13(10)16;/h1-2,4,7-8,13,16H,3,5-6H2,(H,14,15);/q;+1/p-1/b10-8+; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 246.6°C |
| Boiling Point: | 460.8°Cat760mmHg |
| Density: | 1.34g/cm3 |
| Biological Activity: | γ -Hydroxybutyric acid antagonist, anticonvulsant. |
| Flash Point: | 246.6°C |
| Color: | white or off-white |
| Usage: | Possesses antagonistic properties at -hydroxybutyrate (GHB) receptor cites. It antagonizes both the cGMP increase and inositol phosphate accumulation induced by GHB in the hippocampus and suppresses the GHB-induced modification of dopamine relea |
| Safety Data |
| |
 |
