Identification |
Name: | 2-Propenoicacid, 2,3,3-trichloro-, 4-benzoylphenyl ester |
Synonyms: | Acrylicacid, trichloro-, ester with 4-hydroxybenzophenone(8CI); Benzophenone, 4-hydroxy-, trichloroacrylate;NSC 74881 |
CAS: | 13179-02-7 |
Molecular Formula: | C16H9 Cl3 O3 |
Molecular Weight: | 355.5999 |
InChI: | InChI=1/C16H9Cl3O3/c17-13(15(18)19)16(21)22-12-8-6-11(7-9-12)14(20)10-4-2-1-3-5-10/h1-9H |
Molecular Structure: |
 |
Properties |
Flash Point: | 173.2°C |
Boiling Point: | 450.4°Cat760mmHg |
Density: | 1.427g/cm3 |
Refractive index: | 1.609 |
Flash Point: | 173.2°C |
Safety Data |
|
 |