| Identification | |
| Name: | Thiophene,2-bromo-5-nitro- |
| Synonyms: | 2-Nitro-5-bromothiophene;5-Bromo-2-nitrothiophene;NSC 511505; |
| CAS: | 13195-50-1 |
| EINECS: | 236-155-8 |
| Molecular Formula: | C4H2BrNO2S |
| Molecular Weight: | 208.03 |
| InChI: | InChI=1/C4H2BrNO2S/c5-3-1-2-4(9-3)6(7)8/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.945 g/cm3 |
| Refractive index: | 1.647 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
2-Bromo-5-nitrothiophene with CAS number of 13195-50-1 is also called for Labotest-bb lt00455100 ; 2-Bromo-5-nitrothiophene ; 2-Bromo-5-nitrothiophene ,98% ; 2-Nitro-5-bromothiophene ; 5-Nitro-2-bromothiophene ; 2-Bromo-5-Nitrothiophene 99% . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
