| Identification | |
| Name: | Phenyl 1-hydroxy-2-naphthoate |
| Synonyms: | 2-Naphthoicacid, 1-hydroxy-, phenyl ester (6CI,7CI,8CI);1-Hydroxy-2-naphthoic acid phenylester;2-Phenoxycarbonyl-1-naphthol;HS 1094;NSC 1867;Phenyl1-hydroxy-2-naphthalate;Phenyl 1-hydroxy-2-naphthalenecarboxylate; |
| CAS: | 132-54-7 |
| EINECS: | 205-065-0 |
| Molecular Formula: | C17H12O3 |
| Molecular Weight: | 264.28 |
| InChI: | InChI=1/C17H12O3/c18-16-14-9-5-4-6-12(14)10-11-15(16)17(19)20-13-7-2-1-3-8-13/h1-11,18H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.286 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.68 |
| Solubility: | Insoluble |
| Appearance: | Off-white powder. |
| Specification: |
Phenyl 1-hydroxy-2-naphthoate , its CAS NO. is 132-54-7, the synonyms are 1-Hydroxy-2-naphthoic acid phenyl ester ; |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
