| Identification | |
| Name: | Benzoic acid,2-[(1-naphthalenylamino)carbonyl]- |
| Synonyms: | Phthalamicacid, N-1-naphthyl- (7CI,8CI); 1-Naphthylphthalamic acid;2-(1-Naphthylcarbamoyl)benzoic acid; 2-(N-(1-Naphthyl)amido)benzoic acid;2-[(1-Naphthylamino)carbonyl]benzoic acid; Alanap; Alanap 1; Alanap 10G at;Analape; Grelutin; N-1-Naphthylphthalamic acid; N-a-Naphthylphthalamic acid; NPA; NPA (pesticide); NSC204421; Naphthalam; Naptalam |
| CAS: | 132-66-1 |
| EINECS: | 205-073-4 |
| Molecular Formula: | C18H13 N O3 |
| Molecular Weight: | 291.32 |
| InChI: | InChI=1/C18H13NO3/c20-17(14-9-3-4-10-15(14)18(21)22)19-16-11-5-7-12-6-1-2-8-13(12)16/h1-11H,(H,19,20)(H,21,22)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 185-190 °C |
| Flash Point: | 226.4°C |
| Boiling Point: | 450.8°Cat760mmHg |
| Density: | 1.355g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Not hazardous according to Directive 67/548/EC. Toxicity data (The meaning of any toxic |
| Solubility: |
|
| Appearance: | solid with an unpleasant odour |
| Report: |
EPA FIFRA 1988 pesticide subject to registration or re-registration. |
| Flash Point: | 226.4°C |
| Storage Temperature: | 0-6°C |
| Color: | CRYSTALLINE SOLID POWDER, PURPLE |
| Safety Data | |
 |
|
