| Identification | |
| Name: | 4H-1,3-Benzoxazin-4-one,2-(2-chloroethyl)-2,3-dihydro- |
| Synonyms: | 2-(2-Chloroethyl)-2,3-dihydro-4H-1,3-benzoxazin-4-one;2-(2-Chloroethyl)-2H-1,3-benzoxazin-4(3H)-one;2-(2-Chloroethyl)-3,4-dihydro-2H-1,3-benzoxazin-4-one; 2-(b-Chloroethyl)-2,3-dihydro-4-oxo(benzo-1,3-oxazine);4-Oxo-2-(b-chloroethyl)-2,3-dihydrobenzo-1,3-oxazine;Ap 67; Apirazin; Chlorethylbenzmethoxazone; Chlorthenoxazine; NSC 525254;Ossapirina; Ossazone; Piroxina; Reumagrip; Valmorin; Valtorin |
| CAS: | 132-89-8 |
| EINECS: | 205-082-3 |
| Molecular Formula: | C10H10 Cl N O2 |
| Molecular Weight: | 211.66 |
| InChI: | InChI=1/C10H10ClNO2/c11-6-5-9-12-10(13)7-3-1-2-4-8(7)14-9/h1-4,9H,5-6H2,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 225.8°C |
| Boiling Point: | 449.8°Cat760mmHg |
| Density: | 1.253g/cm3 |
| Refractive index: | 1.541 |
| Specification: |
Chlorethylbenzmethoxazone , its cas register number is 132-89-8. It also can be called 2-(2-Chloroethyl)-2,3-dihydro-4-oxo-1,3-benzoxazine ; 2-(2-Chloroethyl)-2,3-dihydro-4H-1,3-benzoxazin-4-one ; 2-(2-Chloroethyl)-3-aza-4-chromanone ; 2-(beta-Chloroethyl)-2,3-dihydro-4-oxo(benzo-1,3-oxazine) ; 4-27-00-02766 (Beilstein Handbook Reference) ; 4-Oxo-2-(beta-chloroethyl)-2,3-dihydrobenzo-1,3-oxazine ; Apirazin ; Chlorethylbenzmethoxazone ; Chlorthenoxazin ; Chlorthenoxazinum ; Clortenoxazina ; Ossazone ; Ossipirina ; Reugaril ; Reumagrip ; and Valmorin . Its classification code is Drug / Therapeutic Agent. |
| Flash Point: | 225.8°C |
| Safety Data | |
 |
|
