| Identification | |
| Name: | METHYL ETHER of PROPYLENE GLYCOL (α) |
| Synonyms: | Solvenon PM;PM (solvent);Propanol,1(or 2)-methoxy-;Arcosolv PM;Dowanol PM;Methoxypropanol;Propanediol methyl ether;Methoxypropanol; |
| CAS: | 1320-67-8 |
| EINECS: | 215-306-1 |
| Molecular Formula: | C4H10O2 |
| Molecular Weight: | 90.121 |
| InChI: | InChI=1S/C4H10O2/c1-3-4(5)6-2/h4-5H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3092 |
| Flash Point: | 39.9°C |
| Boiling Point: | 110.5°Cat760mmHg |
| Density: | 0.912g/cm3 |
| Specification: |
Propylene glycol methyl ether ,its cas register number is 1320-67-8. It also can be called Methoxy-1-propanol ; Propanol, 1(or 2)-methoxy- ; 1-propanol, 1-methoxy- and 1-methoxypropan-1-ol .It is a methoxy-alcohol derivative. Oxidizing agents convert alcohols to aldehydes or ketones. Alcohols exhibit both weak acid and weak base behavior. They may initiate the polymerization of isocyanates and epoxides. Flammable and/or toxic gases are generated by the combination of alcohols with alkali metals, nitrides, and strong reducing agents. They react with oxoacids and carboxylic acids to form esters plus water. |
| Report: |
Glycol ethers are on the Community Right-To-Know List. |
| Packinggroup: | III |
| Flash Point: | 39.9°C |
| Safety Data | |
 |
|
