Identification |
Name: | 6-Methoxy-3-(methoxycarbonyl)-2-(4-nitrophenyl)-4H-benzopyran-4-one |
Synonyms: | 4H-1-benzopyran-3-carboxylic acid, 6-methoxy-2-(4-nitrophenyl)-4-oxo-, methyl ester;methyl 6-methoxy-2-(4-nitrophenyl)-4-oxo-4H-chromene-3-carboxylate |
CAS: | 132018-13-4 |
Molecular Formula: | C18H13NO7 |
Molecular Weight: | 0 |
InChI: | InChI=1/C18H13NO7/c1-24-12-7-8-14-13(9-12)16(20)15(18(21)25-2)17(26-14)10-3-5-11(6-4-10)19(22)23/h3-9H,1-2H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 234.5°C |
Boiling Point: | 544.9°C at 760 mmHg |
Density: | 1.417g/cm3 |
Refractive index: | 1.622 |
Flash Point: | 234.5°C |
Usage: | A useful synthetic intermediate in the preparation of flavinoids |
Safety Data |
|
|