| Identification | |
| Name: | BENZENE,DIISOCYANATOMETHYL- |
| Synonyms: | BENZENE,DIISOCYANATOMETHYL- |
| CAS: | 1321-38-6 |
| Molecular Formula: | C9H6N2O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C9H6N2O2/c1-7-2-3-8(10-5-12)4-9(7)11-6-13/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 19.5-21.5 deg C |
| Boiling Point: | 251 deg C @ 760 mm Hg |
| Solubility: | Miscible with alcohol (decomposition). Miscible with ether, acetone, benzene, carbon tetrachloride, chlorobenzene, diglycol monomethyl ether, kerosene, olive oil; sol in ethyl acetate. |
| Color: | A WATER-WHITE LIQ WHICH TURNS STRAW-COLORED ON STANDING Clear to light yellow liq or crystals Colorless to pale yellow, solid or liquid (above 71 deg F). |
| Safety Data | |
 |
|
