| Identification |
| Name: | Benzene, diethenyl- |
| Synonyms: | Benzene,divinyl- (8CI);DVB 810;DVB 96;DVB 960;DVB-H;DVR 960;Diethenylbenzene;Vinylstyrene; |
| CAS: | 1321-74-0 |
| EINECS: | 215-325-5 |
| Molecular Formula: | C10H10 |
| Molecular Weight: | 131.19 |
| InChI: | InChI=1/2C10H10/c1-3-9-5-7-10(4-2)8-6-9;1-3-9-6-5-7-10(4-2)8-9/h2*3-8H,1-2H2 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | -66.9 |
| Flash Point: | 74.6°C |
| Density: | 0.91 |
| Stability: | Stable in the presence of added inhibitor, but may polymerize in the absence of inhibitor. Light and heat sensitive. Incompatible with heavy metal salts, oxidizing agents, acids. |
| Refractive index: | n20/D 1.561(lit.) |
| Solubility: | |
| Appearance: | colourless liquid |
| Packinggroup: | Z01 |
| Flash Point: | 74.6°C |
| Storage Temperature: | 2-8°C |
| Safety Data |
| |
 |
