| Identification |
| Name: | 1,3-Nonanediol, 1-acetate |
| Synonyms: | 1,3-Nonanediol acetate |
| CAS: | 1322-17-4 |
| EINECS: | 215-332-3 |
| Molecular Formula: | C11H22O3 |
| Molecular Weight: | 202.2906 |
| InChI: | InChI=1/C11H22O3/c1-3-4-5-6-7-11(13)8-9-14-10(2)12/h11,13H,3-9H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.956 g/cm3 |
| Refractive index: | n20/D 1.446(lit.) |
| Water Solubility: | insoluble in water, soluble in oils and organic solvents |
| Solubility: | insoluble in water, soluble in oils and organic solvents |
| Appearance: | colourless to pale yellow clear liquid |
| Safety Data |
| |
 |
