| Identification | |
| Name: | Benzamide,2-hydroxy-N-phenyl-, tribromo deriv. (9CI) |
| Synonyms: | Salicylanilide,tribromo- (7CI,8CI); Tribromosalicylanilide |
| CAS: | 1322-38-9 |
| EINECS: | 201-723-6 |
| Molecular Formula: | C13H8 Br3 N O2 |
| Molecular Weight: | 449.95 |
| InChI: | InChI=1/C13H8Br3NO2/c14-7-1-3-9(4-2-7)17-13(19)10-5-8(15)6-11(16)12(10)18/h1-6,18H,(H,17,19) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 201.2°C |
| Boiling Point: | 409.1°Cat760mmHg |
| Density: | 2.089g/cm3 |
| Refractive index: | 1.728 |
| Specification: |
Tribromsalan , its cas register number is 1322-38-9. It also can be called Salicylanilide, tribromo- ; and Benzamide, 2-hydroxy-N-phenyl-, tribromo deriv. . |
| Flash Point: | 201.2°C |
| Safety Data | |
 |
|
