| Identification | |
| Name: | 2,2-Methylenebis(4-chlorophenol) |
| CAS: | 1322-43-6 |
| EINECS: | 202-567-1 |
| Molecular Formula: | C13H10Cl2O2 |
| Molecular Weight: | 269.12 |
| InChI: | InChI=1S/C13H10Cl2O2/c14-10-1-3-12(16)8(6-10)5-9-7-11(15)2-4-13(9)17/h1-4,6-7,16-17H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Melting Point: | 168-172 °C(lit.) |
| Solubility: | Sparingly sol in toluene; 1 g sol in 1 g of 95% ethanol, in less than 1 g of ether; sol in methanol, isopropyl ether, petroleum ether; sol (with decomp) in alkaline aq solutions In water, 30 mg/L at 25 deg C |
| Color: | Colorless crystals |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
