| Identification | |
| Name: | 3-Pyrrolidinol,1-methyl- |
| Synonyms: | 1-Methyl-3-pyrrolidinol;N-Methyl-3-hydroxypyrrolidine;N-Methyl-3-pyrrolidinol;NSC 89279; |
| CAS: | 13220-33-2 |
| EINECS: | 236-189-3 |
| Molecular Formula: | C5H11NO |
| Molecular Weight: | 101.15 |
| InChI: | InChI=1/C5H11NO/c1-6-3-2-5(7)4-6/h5,7H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 159? |
| Density: | 0.921 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.464 |
| Solubility: | Very soluble |
| Appearance: | Colorless or light yellow liquid |
| Specification: |
3-Pyrrolidinol,1-methyl- , its cas register number is 13220-33-2. It also can be called 1-Methyl-3-pyrrolidinol ; EINECS 236-189-3 ; NSC 89279 . 3-Pyrrolidinol,1-methyl- (CAS NO.13220-33-2) is irritating to eyes, respiratory system and skin. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Flash Point: | 159? |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
