| Identification | |
| Name: | Poly(oxy-1,2-ethanediyl),a-[3-methyl-1-(2-methylpropyl)butyl]-w-hydroxy- |
| Synonyms: | 2-(2,4-dimethylpentan-3-yloxy)ethanol |
| CAS: | 132299-20-8 |
| Molecular Formula: | (C2H4 O)n C9 H20 O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C9H20O2/c1-7(2)9(8(3)4)11-6-5-10/h7-10H,5-6H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 57.5°C |
| Boiling Point: | 192.8°Cat760mmHg |
| Density: | 0.88g/cm3 |
| Refractive index: | 1.428 |
| Specification: |
Solvactant 7 solvent , its cas register number is 132299-20-8. It also can be called alpha-(3-Methyl-1-(2-methylpropyl)butyl)-omega-hydroxypoly(oxy-1,2-ethanediyl) ; and Poly(oxy-1,2-ethanediyl), alpha-(3-methyl-1-(2-methylpropyl)butyl)-omega-hydroxy- . |
| Flash Point: | 57.5°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
