| Identification |
| Name: | Propanoic acid,2-hydroxy-, tetradecyl ester |
| Synonyms: | Lacticacid, tetradecyl ester (8CI);Cegesoft C 17;Ceraphyl 50;Crodamol ML;DermolML;Myristyl lactate;Tetradecyl lactate; |
| CAS: | 1323-03-1 |
| EINECS: | 215-350-1 |
| Molecular Formula: | C17H34O3 |
| Molecular Weight: | 286.4501 |
| InChI: | InChI=1/C17H34O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-20-17(19)16(2)18/h16,18H,3-15H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.922 g/cm3 |
| Refractive index: | 1.453 |
| Appearance: | White to slightly yellowish solid mass with mild inherent odour |
| Safety Data |
| |
 |
