| Identification |
| Name: | b-D-Glucopyranose, 1,6-anhydro-,2,3,4-triacetate |
| Synonyms: | Levoglucosan,triacetate (6CI,7CI,8CI);b-D-Glucopyranose, 1,6-anhydro-, triacetate (9CI);1,6-Anhydro-2,3,4-tri-O-acetyl-b-D-glucopyranose;1,6-Anhydro-b-D-glucopyranose triacetate;2,3,4-Tri-O-acetyl-1,6-anhydro-b-D-glucopyranose;NSC 25284;Triacetyllevoglucosan; |
| CAS: | 13242-55-2 |
| EINECS: | 236-222-1 |
| Molecular Formula: | C12H16O8 |
| Molecular Weight: | 288.2506 |
| InChI: | InChI=1/C12H16O8/c1-5(13)17-9-8-4-16-12(20-8)11(19-7(3)15)10(9)18-6(2)14/h8-12H,4H2,1-3H3/t8-,9-,10+,11-,12-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.34 g/cm3 |
| Refractive index: | 1.494 |
| Appearance: | white powder. |
| Usage: | 1,6-Anhydrohexopyranoses have proven to be valuable synthons for the preparation of biologically important and structurally diverse products (e.g. rifamycin S, indanomycin, thromboxane B2, (+)-biotin, tetrodotoxin, quinone, and macrolide antibiotics) as |
| Safety Data |
| |
 |
