Identification |
Name: | Benzene, dodecylphenoxy-, branched and linear |
Synonyms: | 1-dodecyl-4-phenoxybenzene;1-Propene tetramer-oxybisbenzene reaction products;119345-02-7;Alkylated diphenyl oxide;AC1L3BGT;Benzene, dodecylphenoxy-, branched and linear;Benzene, 1-phenoxy-4-dodecyl-;Diphenyl ether tetrapropylene derivs.;Branched and linear dodecylphenoxybenzene;LS-195717;Benzene, 1,1'-oxybis-, tetrapropylene derivs;132493-28-8 |
CAS: | 132493-28-8 |
Molecular Formula: | C24H34O |
Molecular Weight: | 338.52616 |
InChI: | InChI=1S/C24H34O/c1-2-3-4-5-6-7-8-9-10-12-15-22-18-20-24(21-19-22)25-23-16-13-11-14-17-23/h11,13-14,16-21H,2-10,12,15H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 217.4°C |
Boiling Point: | 436.3°Cat760mmHg |
Density: | 0.945g/cm3 |
Flash Point: | 217.4°C |
Safety Data |
|
 |