| Identification |
| Name: | (1-(4-MORPHOLINYL)PROPYL)BENZOTRIAZOLE |
| Synonyms: | (1-(4-MORPHOLINYL)PROPYL)BENZOTRIAZOLE, 90%, MIXTURE OF BT1 & BT2 ISOMERS;[1-(4-morpholinyl)propyl]benzotriazole, mixture of bt1 and bt2 isomers |
| CAS: | 132553-13-0 |
| Molecular Formula: | C13H18N4O |
| Molecular Weight: | 246.30822 |
| InChI: | InChI=1/C13H18N4O/c1-2-13(16-7-9-18-10-8-16)17-12-6-4-3-5-11(12)14-15-17/h3-6,13H,2,7-10H2,1H3 |
| Molecular Structure: |
![(C13H18N4O) (1-(4-MORPHOLINYL)PROPYL)BENZOTRIAZOLE, 90%, MIXTURE OF BT1 & BT2 ISOMERS;[1-(4-morpholinyl)propyl]b...](https://img.guidechem.com/structure/132553-13-0.gif) |
| Properties |
| Melting Point: | 98-101 °C(lit.) |
| Flash Point: | 190.2°C |
| Boiling Point: | 390.9°C at 760 mmHg |
| Density: | 1.27g/cm3 |
| Refractive index: | 1.645 |
| Flash Point: | 190.2°C |
| Safety Data |
| |
 |
