| Identification | |
| Name: | octyl hexyl hexanedioate |
| Synonyms: | hexyl octyl adipate;132752-18-2;hexyl octyl hexanedioate;AC1L3BGW;AC1Q674L;Hexanedioic acid, mixed decyl and hexyl and octyl esters;1-O-hexyl 6-O-octyl hexanedioate;Hexanedioic acid, hexyl octyl ester;AR-1J1937;Hexanedioic acid, mixed hexyl, octyl and decyl esters |
| CAS: | 132752-18-2 |
| Molecular Formula: | C20H38O4 |
| Molecular Weight: | 342.51332 |
| InChI: | InChI=1S/C20H38O4/c1-3-5-7-9-10-14-18-24-20(22)16-12-11-15-19(21)23-17-13-8-6-4-2/h3-18H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 168.2°C |
| Boiling Point: | 375.2°Cat760mmHg |
| Density: | 0.936g/cm3 |
| Flash Point: | 168.2°C |
| Safety Data | |
 |
|
