Identification |
Name: | 1,4-bis(4-methyl-α-styryl)benzene |
Synonyms: | Benzene,p-bis(o-methylstyryl)- (7CI,8CI); 1,4-Bis(2-methylstyryl)benzene;1,4-Bis(o-methylstyryl)benzene; 1,4-Bis[2-(2-methylphenyl)ethenyl]benzene;Bis-MSB; DST; DST (hole transport material); p-Bis(2-methylstyryl)benzene;p-Bis(o-methylstyryl)benzene |
CAS: | 13280-61-0 |
EINECS: | 236-285-5 |
Molecular Formula: | C24H22 |
Molecular Weight: | 310.43148 |
InChI: | InChI=1S/C24H22/c1-19-7-3-5-9-23(19)17-15-21-11-13-22(14-12-21)16-18-24-10-6-4-8-20(24)2/h3-18H,1-2H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 180-182 °C(lit.)
|
Flash Point: | 231.3°C |
Boiling Point: | 463.1°Cat760mmHg |
Density: | 1.076g/cm3 |
Stability: | Stable. Incompatible with strong oxidizing agents. |
Refractive index: | 1.693 |
Water Solubility: | negligible Stability Stable. Incompatible with strong oxidizing agents. Toxicology Irritant. Toxicity data (The meaning of any toxicological abbreviations which |
Solubility: | negligible |
Appearance: | yellow-green crystals |
Flash Point: | 231.3°C |
Storage Temperature: | −20°C |
Safety Data |
|
|