| Identification |
| Name: | Propanedioic acid,2-butyl-, 1,3-diethyl ester |
| Synonyms: | Malonicacid, butyl-, diethyl ester (6CI,7CI,8CI);Propanedioic acid, butyl-, diethylester (9CI);Butylmalonic acid diethyl ester;Butylpropanedioic acid diethylester;Diethyl 2-butylmalonate;Diethyl n-butylmalonate;Diethyl a-butylmalonate;Ethylbutylmalonate;NSC 4565; |
| CAS: | 133-08-4 |
| EINECS: | 205-089-1 |
| Molecular Formula: | C11H20O4 |
| Molecular Weight: | 216.28 |
| InChI: | InChI=1/C11H20O4/c1-4-7-8-9(10(12)14-5-2)11(13)15-6-3/h9H,4-8H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 190kgs |
| Melting Point: | 119 |
| Density: | 0.983 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.421-1.423 |
| Water Solubility: | freely soluble |
| Solubility: | freely soluble | Appearance: | clear liquid |
| HS Code: | 29171990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
|
| |
 |
