| Identification | |
| Name: | Benzenethiol,2,3,4,5,6-pentachloro- |
| Synonyms: | Benzenethiol,pentachloro- (6CI,7CI,8CI,9CI); AP; NSC 5578; Pentachlorobenzenethiol;Pentachlorothiophenol; RPA 6; Struktol A 95 |
| CAS: | 133-49-3 |
| EINECS: | 205-107-8 |
| Molecular Formula: | C6H Cl5 S |
| Molecular Weight: | 282.38 |
| InChI: | InChI=1/C6HCl5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3335 |
| Density: | 1.745 g/cm3 |
| Refractive index: | 1.648 |
| Solubility: | In water, 4.8X10-3 mg/L at 25 deg C (est) |
| Appearance: | Off-white to White Powder |
| Report: |
Chlorophenol compounds are on The Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Sensitive: | Stench |
| Safety Data | |
 |
|
