Identification |
Name: | 2-Thiophenepropanoicacid, a-[[2-butyl-1-[(4-carboxyphenyl)methyl]-1H-imidazol-5-yl]methylene]-,(aE)- |
Synonyms: | 2-Thiophenepropanoicacid, a-[[2-butyl-1-[(4-carboxyphenyl)methyl]-1H-imidazol-5-yl]methylene]-,(E)-;(E)-2-Butyl-1-(p-carboxybenzyl)-a-2-thenylimidazole-5-acrylic acid;SKB108566;SKF 108566;Teveten; |
CAS: | 133040-01-4 |
Molecular Formula: | C23H24N2O4S |
Molecular Weight: | 424.51 |
InChI: | InChI=1/C23H24N2O4S/c1-2-3-6-21-24-14-19(12-18(23(28)29)13-20-5-4-11-30-20)25(21)15-16-7-9-17(10-8-16)22(26)27/h4-5,7-12,14H,2-3,6,13,15H2,1H3,(H,26,27)(H,28,29)/b18-12+ |
Molecular Structure: |
|
Properties |
Flash Point: | 353.3°C |
Boiling Point: | 660.6°Cat760mmHg |
Density: | 1.26g/cm3 |
Refractive index: | 1.627 |
Solubility: | In water, 1.9X10-2 mg/L at 25 deg C (est) |
Flash Point: | 353.3°C |
Usage: | Prototype of the imidazoleacrylic acid angiotensin II receptor antagonists. Antihypertensive |
Safety Data |
|
|