| Identification | |
| Name: | 3-Pyridinecarboxylicacid, 6-hydrazinyl- |
| Synonyms: | 3-Pyridinecarboxylicacid, 6-hydrazino- (9CI); |
| CAS: | 133081-24-0 |
| Molecular Formula: | C6H7N3O2 |
| Molecular Weight: | 153.14 |
| InChI: | InChI=1/C6H7N3O2/c7-9-5-2-1-4(3-8-5)6(10)11/h1-3H,7H2,(H,8,9)(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.504g/cm3 |
| Refractive index: | 1.71 |
| Specification: |
3-Pyridinecarboxylicacid, 6-hydrazinyl- , its cas register number is 133081-24-0. It also can be called 6-hydrazinopyridine-3-carboxylic acid ; 6-hydrazinonicotinic acid . 3-Pyridinecarboxylicacid, 6-hydrazinyl- (CAS NO.133081-24-0) is irritating to eyes, respiratory system and skin. And it is harmful by inhalation, in contact with skin and if swallowed. |
| Safety Data | |
 |
|
