| Identification | |
| Name: | boron trifluoride dihydrate |
| Synonyms: | Boron Trifluor Hydnate Complex |
| CAS: | 13319-75-0 |
| EINECS: | 231-569-5 |
| Molecular Formula: | BF3?2(H2O) |
| Molecular Weight: | 103.83 |
| InChI: | InChI=1/BF3.2H2O/c2-1(3)4;;/h;2*1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2851 |
| Flash Point: | °C |
| Density: | 1.642 |
| Stability: | No data. |
| Refractive index: | n20/D 1.316(lit.) |
| Water Solubility: | miscible |
| Solubility: | Miscible with water |
| Appearance: | colourless liquid |
| Specification: |
Boron trifluoride dihydrate (13319-75-0) also can be called Trifluoroborane dihydrate ; Boron fluoride dihydrate ;and Borane, trifluoro-, dihydrate .It may be corrosive to skin, eyes and mucous membranes and may be toxic by inhalation.Upon contact with water, steam or when heated to decomposition, it will produce toxic fluoride fumes. Incompatible with alkyl nitrates, calcium oxide. Reaction with alkali metals or alkaline earth metals (except magnesium) will cause incandescence. |
| Packinggroup: | II |
| Flash Point: | °C |
| Storage Temperature: | The product must be stored cool and dry in tightly sealed container or tank. Storage tanks must be drained at regular intervals, washed out and inspected. When stored or transported in pressure-resistant tanks the product can be kept under an atmosphere of nitrogen. |
| Usage: | For selective reaction control in numerous organic reactions, primarily as a catalyst or cocatalyst. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
C:Corrosive
|
 |
|
