| Identification | |
| Name: | b-D-Glucopyranosiduronic acid,(R)-cyanophenylmethyl |
| Synonyms: | b-D-Glucopyranosiduronic acid,cyanophenylmethyl, (R)-; Laetrile; Mandelonitrile b-glucuronide; NSC 103055; Vitamin B17 |
| CAS: | 1332-94-1 |
| Molecular Formula: | C14H15 N O7 |
| Molecular Weight: | 309.30 |
| InChI: | InChI=1/C14H15NO7/c15-6-8(7-4-2-1-3-5-7)21-14-11(18)9(16)10(17)12(22-14)13(19)20/h1-5,8-12,14,16-18H,(H,19,20)/t8-,9-,10-,11+,12-,14+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.55g/cm3 |
| Refractive index: | 1.634 |
| Specification: |
Removal in wastewater treatment of Laetrile (CAS NO.1332-94-1) : |
| Report: |
Cyanide and its compounds are on The Community Right-To-Know List. |
| Safety Data | |
 |
|
