| Identification | |
| Name: | DL-1-Phenylethanol |
| Synonyms: | - |
| CAS: | 13323-81-4 |
| EINECS: | 202-707-1 |
| Molecular Formula: | C8H10O |
| Molecular Weight: | 122.16 |
| InChI: | InChI=1S/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2937 6.1/PG 3 |
| Melting Point: | 19-20 °C(lit.) |
| Flash Point: | 185 °F |
| Boiling Point: | 204 °C745 mm Hg(lit.) |
| Density: | 1.012 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.527(lit.) |
| Solubility: | Sol in glycerol, mineral oil, alcohol SOL IN MOST ORGANIC SOLVENTS A high solvency for alcohol-soluble cellulose nitrate, cellulose acetate, and cellulose acetobutyrate; for many natural and synthetic resins; and for fats and oils. In contrast to benzyl alcohol, it is miscible with white spirit. In water, 1,950 mg/l @ 25 deg C |
| Packinggroup: | III |
| Flash Point: | 185 °F |
| Color: | COLORLESS LIQ |
| Safety Data | |
 |
|
