| Identification | |
| Name: | Chromium(VI) oxide |
| Synonyms: | Chromic acid, polymer-supported; Chromic anhydride; Chromium trioxide; Chromiumoxide; Chromic acid; Chromium Oxide |
| CAS: | 1333-82-0 |
| EINECS: | 215-607-8 |
| Molecular Formula: | CrO3 |
| Molecular Weight: | 99.99 |
| InChI: | InChI=1/Cr.3O/rCrO3/c2-1(3)4 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1463 |
| Density: | 2.7g/cm3 |
| Stability: | Stable. Strong oxidizer. Reacts with most organic material in a violent and often explosive fashion. Moisture sensitive. |
| Solubility: | Highly soluble |
| Appearance: | dark red crystals or powder |
| Specification: | Chromium trioxide (CAS NO.10043-01-3) is highly toxic, corrosive and carcinogenic. It is the main example of the environmental hazard known as "hexavalent chromium". The related chromium (III) derivatives are not particularly dangerous, thus reductants are used to destroy chromium(VI) samples. Chromium trioxide, being a powerful oxidizer, will ignite some organic materials (such as ethanol) on contact. |
| Packinggroup: | II |
| HS Code: | 28191000 |
| Storage Temperature: | Do not store near combustible materials. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Sensitive: | Hygroscopic |
| Color: | Dark red, bipyramidal prismatic crystals, flakes or granular powder Brown solid Flake, ground powder form Dark-red flakes or powder [Note: Often used in an aqueous solution (H2CrO4)]. |
| Usage: | Medication (vet). |
| Safety Data | |
| Hazard Symbols |
O:Oxidizingagent
T+:Verytoxic
N:Dangerousfortheenvironment
|
 |
|
