Identification |
Name: | Prosta-8(12),13-dien-1-oicacid, 15-hydroxy-9-oxo-, (13E,15S)- |
Synonyms: | 9-Oxo-15S-hydroxy-8(12),13E-prostadienoic acid; |
CAS: | 13345-51-2 |
EINECS: | 234-237-8 |
Molecular Formula: | C20H32O4 |
Molecular Weight: | 336.46568 |
InChI: | InChI=1S/C20H32O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h12,14,17,21H,2-11,13,15H2,1H3,(H,23,24)/b14-12+/t17-/m0/s1 |
Molecular Structure: |
 |
Properties |
Density: | 1.101 g/cm3 |
Refractive index: | 1.549 |
Water Solubility: | acetone: 20 mg/mL, clear, colorless to very faintly yellow |
Solubility: | acetone: 20 mg/mL, clear, colorless to very faintly yellow |
Storage Temperature: | −20°C |
Color: | white to light yellow |
Safety Data |
|
 |