| Identification | |
| Name: | Phenol,4-chloro-2-cyclopentyl- |
| Synonyms: | 2-Cyclopentyl-4-chlorophenol;4-Chloro-2-cyclopentylphenol; Dowicide 9 |
| CAS: | 13347-42-7 |
| EINECS: | 236-395-3 |
| Molecular Formula: | C11H13 Cl O |
| Molecular Weight: | 196.69 |
| InChI: | InChI=1/C11H13ClO/c12-9-5-6-11(13)10(7-9)8-3-1-2-4-8/h5-8,13H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2021 |
| Flash Point: | 103.6°C |
| Boiling Point: | 247.6°C at 760 mmHg |
| Density: | 1.204g/cm3 |
| Refractive index: | 1.579 |
| Specification: |
4-chloro-2-cyclopentylphenol , its CAS NO. is 13347-42-7, the synonyms are 2-Cyclopentyl-p-chlorophenol ; 3-06-00-02478 (Beilstein Handbook Reference) ; BRN 2050430 ; Caswell No. 186 ; Dowicide 9 ; EINECS 236-395-3 ; EPA Pesticide Chemical Code 064202 ; Phenol, 4-chloro-2-cyclopentyl- . |
| Report: |
Chlorophenol compounds are on the Community Right-To-Know List. |
| Packinggroup: | III |
| Flash Point: | 103.6°C |
| Safety Data | |
 |
|
