| Identification | |
| Name: | Heptenol, methyl- |
| Synonyms: | Methylheptenol |
| CAS: | 1335-09-7 |
| EINECS: | 215-619-3 |
| Molecular Formula: | C8 H18 O |
| Molecular Weight: | 128.24 |
| InChI: | InChI=1/C8H16O/c1-3-4-5-6-7-8(2)9/h7,9H,3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 68.2°C |
| Boiling Point: | 182.4°Cat760mmHg |
| Density: | 0.843g/cm3 |
| Refractive index: | n20/D 1.448(lit.) |
| Specification: |
6-Methyl-6-hepten-2-ol , its cas register number is 1335-09-7. It also can be called 6-Hepten-2-ol, 6-methyl- ; trans-6-Methyl-3-hepten-1-ol ; (E)-6-Methylhept-3-en-1-ol ; and Heptenol, methyl- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 68.2°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
