| Identification | |
| Name: | Acetic acid, 2-cyano-,2-methylpropyl ester |
| Synonyms: | Aceticacid, cyano-, 2-methylpropyl ester (9CI);Acetic acid, cyano-, iso-butyl ester(7CI);Acetic acid, cyano-, isobutyl ester (6CI,8CI);Cyanoacetic acid isobutylester; |
| CAS: | 13361-31-4 |
| EINECS: | 236-422-9 |
| Molecular Formula: | C7H11NO2 |
| Molecular Weight: | 141.17 |
| InChI: | InChI=1/C7H11NO2/c1-6(2)5-10-7(9)3-4-8/h6H,3,5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -26 |
| Density: | 0.993 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4212-1.4232 |
| Water Solubility: | IMMISCIBLE |
| Solubility: | Immiscible with water |
| Appearance: | colourless transparent liquid |
| Specification: |
Isobutyl cyanoacetate (13361-31-4),which also can be called for Cyanoacetic acia isobutyl ester ; IBCY ; Isobutyryl cyanoacetate ; Isobutylcyanoacetate ; 2-Methylpropyl cyanoacetate ; Acetic acid,cyano-,2-Methylpropyl ester ; Cyano-aceticaci2-methylpropylester ; Cyano-aceticaciisobutylester . Isobutyl cyanoacetate (13361-31-4) is a clear colourless liquid and it's very soluble in water.This chemical should be stored in a cool,dry place.Store in a tightly closed container.Wash thoroughly after handling it.It's stable under normal temperatures and pressures.After decomposition, Isobutyl cyanoacetate (13361-31-4) turned into Carbon monoxide , Oxides of nitrogen and Carbon dioxide .Be attention of it's a poisonous chemical. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
