| Identification | |
| Name: | 6H-Purin-6-one,2-chloro-1,7-dihydro- |
| Synonyms: | Hypoxanthine,2-chloro- (6CI,7CI,8CI);2-Chloro-6-hydroxypurine;2-Chlorohypoxanthine;NSC12159; |
| CAS: | 13368-14-4 |
| Molecular Formula: | C5H3ClN4O |
| Molecular Weight: | 170.56 |
| InChI: | InChI=1/C5H3ClN4O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1-2H,(H,7,8,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 271.4°C |
| Boiling Point: | 525.2°Cat760mmHg |
| Density: | 2.09g/cm3 |
| Refractive index: | 1.91 |
| Specification: |
2-Chloro-6-hydroxypurine with cas registry number of 13368-14-4 is a kind of Purines which is much more soluble than xanthine in Phosphorus oxychloride . It is also called 2-Chlorohypoxanthine ; 2-Chloro-3,7-dihydro-6H-purin-6-one . This compound can be prepared other chemicals such as N2-Ethylguanine , N2-guanine . |
| Flash Point: | 271.4°C |
| Safety Data | |
 |
|
