| Identification |
| Name: | Cyclopropanemethanamine,a-cyclopropyl- |
| Synonyms: | Methylamine,1,1-dicyclopropyl- (7CI,8CI);1,1-Dicyclopropylmethanamine;Dicyclopropylmethylamine; |
| CAS: | 13375-29-6 |
| EINECS: | 236-451-7 |
| Molecular Formula: | C7H13N |
| Molecular Weight: | 111.18 |
| InChI: | InChI=1/C7H13N/c8-7(5-1-2-5)6-3-4-6/h5-7H,1-4,8H2 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | -52 |
| Flash Point: | 45.7°C |
| Boiling Point: | 161.2°Cat760mmHg |
| Density: | 1.092g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.46 (20 C) |
| Solubility: | Very soluble |
| Packinggroup: | I; II; III |
| Flash Point: | 45.7°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| |
 |
