| Identification | |
| Name: | 4,7-Methano-5H-inden-5-one,octahydro- |
| Synonyms: | 4,7-Methanoindan-5(4H)-one,tetrahydro- (6CI,7CI,8CI); 8-Ketotricyclo[5.2.1.02,6]decane;8-Oxotricyclo[5.2.1.02,6]decane; NSC 77098; Tricyclo[5.2.1.02,6]decan-8-one |
| CAS: | 13380-94-4 |
| EINECS: | 236-458-5 |
| Molecular Formula: | C10H14 O |
| Molecular Weight: | 150.24 |
| InChI: | InChI=1/C10H14O/c11-10-5-6-4-9(10)8-3-1-2-7(6)8/h6-9H,1-5H2/t6-,7-,8-,9-/m1/s1 |
| Molecular Structure: | ![(C10H14O) 4,7-Methanoindan-5(4H)-one,tetrahydro- (6CI,7CI,8CI); 8-Ketotricyclo[5.2.1.02,6]decane;8-Oxotricyclo...](https://img1.guidechem.com/chem/e/dict/2/13380-94-4.jpg) |
| Properties | |
| Flash Point: | 101.1 ºC |
| Boiling Point: | 234.9ºC at 760 mmHg |
| Density: | 1.105 g/cm3 |
| Refractive index: | 1.535 |
| Specification: |
4,7-Methano-5H-inden-5-one, octahydro- (13380-94-4) also can be called 8-Ketotricyclo[5.2.1.02,6]decane ; Corodane and 4,7-Methanoindan-5(4H)-one, tetrahydro- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 101.1 ºC |
| Safety Data | |
 |
|
