| Identification | |
| Name: | N,N-Diethyl-3-methylbenzamide |
| Synonyms: | DETA; DEET; N,N-Diethyl-m-toluamide; m-Toluic acid diethylamide; 3-methyl-2-deutero-N,N-diethylbenzamide; 3-Methyl-N,N-diethylbenzamide; A.I. 3-22542; AI 3-22542; ai3-22542; amincenec-em; Autan; Baker'S antifol; DEET; N,N-diethyl-3-methyl-Benzamide; n,n-diethyl-m-toluamid |
| CAS: | 134-62-3 |
| EINECS: | 205-149-7 |
| Molecular Formula: | C12H17NO |
| Molecular Weight: | 191.27 |
| InChI: | InChI=1/C12H17NO/c1-4-13(5-2)12(14)11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Melting Point: | -45 |
| Density: | 0.9955 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong acids, strong bases. Hydrolyzes slowly in water. |
| Refractive index: | 1.52-1.524 |
| Water Solubility: | NEGLIGIBLE |
| Solubility: | negligible |
| Appearance: | Colorless to Amberlike Liquid |
| Specification: |
General Information: As in any fire, wear a self-contained breathing apparatus in pressure-demand, MSHA/NIOSH (approved or equivalent), and full protective gear. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29242995 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Liquid WATER WHITE TO AMBER |
| Usage: | Insect repellent |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
