| Identification | |
| Name: | 1-Propanone,2-(diethylamino)-1-phenyl-, hydrochloride (1:1) |
| Synonyms: | 1-Propanone,2-(diethylamino)-1-phenyl-, hydrochloride (9CI); Propiophenone,2-(diethylamino)-, hydrochloride (6CI,8CI);1-Phenyl-2-(diethylamino)propanone-1 hydrochloride;2-(Diethylamino)propiophenone hydrochloride; Amfepramon hydrochloride;Amphepramonum hydrochloride; Anfamon; Anorex; Danylen; Diethylpropionhydrochloride; Diethylpropione hydrochloride; Dobesin; Fepranon; Frekentine;Keramik; Keramin; Moderatan; Modulor; Parabolin; Phepranon; Prefamone; Regenon;Regenon hydrochloride; Tenuate; Tenuate hydrochloride; Tenuate-Dospan; Tepanil;Tylinal; a-(Diethylamino)propiophenonehydrochloride; a-Benzoyltriethylaminehydrochloride; a-Benzoyltriethylammoniumchloride |
| CAS: | 134-80-5 |
| EINECS: | 205-156-5 |
| Molecular Formula: | C13H19 N O . Cl H |
| Molecular Weight: | 241.79 |
| InChI: | InChI=1/C13H19NO.ClH/c1-4-14(5-2)11(3)13(15)12-9-7-6-8-10-12;/h6-11H,4-5H2,1-3H3;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 180-1810C |
| Flash Point: | 95.4°C |
| Boiling Point: | 292°Cat760mmHg |
| Density: | 0.972g/cm3 |
| Specification: |
2-Diethylaminopropiophenone Hydrochloride (CAS NO.134-80-5) is a off-white solid. |
| Flash Point: | 95.4°C |
| Usage: |
2-Diethylaminopropiophenone Hydrochloride (CAS NO.134-80-5) can be used to controlled substance (stimulant) and used as anorexic. |
| Safety Data | |
 |
|
