| Identification | |
| Name: | Benzil |
| Synonyms: | Dibenzoyl; Diphenylethanedione; Melting point standard benzil |
| CAS: | 134-81-6 |
| EINECS: | 205-157-0 |
| Molecular Formula: | C14H10O2 |
| Molecular Weight: | 210.23 |
| InChI: | InChI=1/C14H10O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 346 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.594 |
| Solubility: | Insoluble (but soluble in ethanol and ether) AUTOIGNITION |
| Appearance: | yellow crystals |
| HS Code: | 29143900 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Substance is used in organic syntheses. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
