Identification |
Name: | Benzenecarbothioicacid, S-(phenylmethyl) ester |
Synonyms: | Benzoicacid, thio-, S-benzyl ester (7CI,8CI); a-Toluenethiol, benzoate (6CI); NSC 79263; S-Benzylbenzenecarbothioate; S-Benzyl benzothioate; S-Benzyl thiobenzoate; Thiobenzoicacid S-benzyl ester; Tibenzate |
CAS: | 13402-51-2 |
Molecular Formula: | C14H12 O S |
Molecular Weight: | 228.32 |
InChI: | InChI=1/C14H12OS/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 146.5°C |
Boiling Point: | 341°Cat760mmHg |
Density: | 1.167g/cm3 |
Refractive index: | 1.62 |
Specification: |
Tibenzate , its cas register number is 13402-51-2. It also can be called S-Benzyl benzenecarbothioate ; alpha-Toluenethiol, benzoate (6CI) ; and Benzenecarbothioic acid, S-(phenylmethyl) ester (9CI) .
|
Flash Point: | 146.5°C |
Safety Data |
|
|