| Identification | |
| Name: | Benzenecarbothioicacid, S-(phenylmethyl) ester |
| Synonyms: | Benzoicacid, thio-, S-benzyl ester (7CI,8CI); a-Toluenethiol, benzoate (6CI); NSC 79263; S-Benzylbenzenecarbothioate; S-Benzyl benzothioate; S-Benzyl thiobenzoate; Thiobenzoicacid S-benzyl ester; Tibenzate |
| CAS: | 13402-51-2 |
| Molecular Formula: | C14H12 O S |
| Molecular Weight: | 228.32 |
| InChI: | InChI=1/C14H12OS/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 146.5°C |
| Boiling Point: | 341°Cat760mmHg |
| Density: | 1.167g/cm3 |
| Refractive index: | 1.62 |
| Specification: |
Tibenzate , its cas register number is 13402-51-2. It also can be called S-Benzyl benzenecarbothioate ; alpha-Toluenethiol, benzoate (6CI) ; and Benzenecarbothioic acid, S-(phenylmethyl) ester (9CI) . |
| Flash Point: | 146.5°C |
| Safety Data | |
 |
|
