| Identification | |
| Name: | 2-Hexenoic acid, (2E)- |
| Synonyms: | 2-Hexenoicacid, (E)- (8CI);(E)-2-Hexenoic acid;trans-2-Hexenoic acid;(2E)-Hex-2-enoic acid;(2E)-2-Hexenoic acid; |
| CAS: | 13419-69-7 |
| EINECS: | 236-528-5 |
| Molecular Formula: | C6H10O2 |
| Molecular Weight: | 114.14 |
| InChI: | InChI=1S/C6H10O2/c1-2-3-4-5-6(7)8/h4-5H,2-3H2,1H3,(H,7,8)/b5-4+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2829 |
| Density: | 0.985 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4385 |
| Solubility: | Very soluble |
| Appearance: | White solid. |
| Specification: |
2-Hexenoic acid, (2E)- , with CAS number of 13419-69-7, can be called (2E)-Hex-2-enoic acid ; (2E)-2-Hexenoic acid ; (E)-2-Hexenoic acid ; (E)-hex-2-enoic acid ; (Z)-2-Hexenoic acid . It is a white crystalline low melting solid. |
| Packinggroup: | III |
| Storage Temperature: | Keep container closed when not in use. Keep under a nitrogen blanket. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
