Identification |
Name: | Acetic acid,2,2-dichloro-, ion(1-) |
Synonyms: | Aceticacid, dichloro-, ion(1-) (8CI,9CI); Dichloroacetate; Dichloroacetate anion;Dichloroacetate ion; Dichloroacetate ion(1-) |
CAS: | 13425-80-4 |
EINECS: | 201-202-3 |
Molecular Formula: | C2H Cl2 O2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C2H2Cl2O2/c3-1(4)2(5)6/h1H,(H,5,6)/p-1 |
Molecular Structure: |
 |
Properties |
Melting Point: | Apparently occurs in two crystal forms, mp 9.7 deg C and -4 deg C |
Flash Point: | 75.6°C |
Boiling Point: | 194°C at 760 mmHg |
Solubility: | Miscible with ethanol, diethyl ether; soluble in acetone; slightly soluble in carbon tetrachloride Miscible with water |
Flash Point: | 75.6°C |
Color: | Colorless liquid |
Safety Data |
|
 |