| Identification | |
| Name: | Acetic acid,2,2-dichloro-, ion(1-) |
| Synonyms: | Aceticacid, dichloro-, ion(1-) (8CI,9CI); Dichloroacetate; Dichloroacetate anion;Dichloroacetate ion; Dichloroacetate ion(1-) |
| CAS: | 13425-80-4 |
| EINECS: | 201-202-3 |
| Molecular Formula: | C2H Cl2 O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C2H2Cl2O2/c3-1(4)2(5)6/h1H,(H,5,6)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | Apparently occurs in two crystal forms, mp 9.7 deg C and -4 deg C |
| Flash Point: | 75.6°C |
| Boiling Point: | 194°C at 760 mmHg |
| Solubility: | Miscible with ethanol, diethyl ether; soluble in acetone; slightly soluble in carbon tetrachloride Miscible with water |
| Flash Point: | 75.6°C |
| Color: | Colorless liquid |
| Safety Data | |
 |
|
