| Identification |
| Name: | Iodic acid (HIO3),ammonium salt (1:1) |
| Synonyms: | Ammoniumiodate ((NH4)IO3) (7CI); Ammonium iodate (6CI); Iodic acid (HIO3), ammoniumsalt (8CI,9CI); Ammonium iodine oxide (NH4IO3) |
| CAS: | 13446-09-8 |
| EINECS: | 231-831-9 |
| Molecular Formula: | H3N . H I O3 |
| Molecular Weight: | 192.94113 |
| InChI: | InChI=1S/HIO3.H3N/c2-1(3)4;/h(H,2,3,4);1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1479 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Stability: | Stable. Oxidizer - contact with combustible material may lead to fire. Incompatible with organics, combustible materials, reducing agents, powdered metals. May be light sensitive. |
| Water Solubility: | 20.6 g/l at 15 C in water |
| Solubility: | 20.6 g/l at 15 C in water |
| Appearance: | white crystalline powder |
| Packinggroup: | II |
| Flash Point: | °C |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
O: Oxidizing agent
|
| |
 |
