Identification |
Name: | Urea,N-[3-[3-(4-fluorophenoxy)phenyl]-1-methyl-2-propen-1-yl]-N-hydroxy- |
Synonyms: | Urea,N-[3-[3-(4-fluorophenoxy)phenyl]-1-methyl-2-propenyl]-N-hydroxy- (9CI); BW-B 70C |
CAS: | 134470-38-5 |
Molecular Formula: | C17H17 F N2 O3 |
Molecular Weight: | 316.33 |
InChI: | InChI=1/C17H17FN2O3/c1-12(20(22)17(19)21)5-6-13-3-2-4-16(11-13)23-15-9-7-14(18)8-10-15/h2-12,22H,1H3,(H2,19,21)/b6-5+ |
Molecular Structure: |
![(C17H17FN2O3) Urea,N-[3-[3-(4-fluorophenoxy)phenyl]-1-methyl-2-propenyl]-N-hydroxy- (9CI); BW-B 70C](https://img1.guidechem.com/chem/e/dict/228/134470-38-5.jpg) |
Properties |
Flash Point: | 255.5°C |
Boiling Point: | 498.9°C at 760 mmHg |
Density: | 1.295g/cm3 |
Refractive index: | 1.627 |
Biological Activity: | A potent, selective inhibitor of 5-lipoxygenase. In vivo, has a long half-life and high oral bioavailability. |
Flash Point: | 255.5°C |
Storage Temperature: | 2-8°C |
Color: | white |
Safety Data |
|
 |