| Identification | |
| Name: | 1,4-Benzenediamine,2-fluoro-5-nitro- |
| Synonyms: | 1,4-Diamino-5-fluoro-2-nitrobenzene;2-Fluoro-5-nitro-p-phenylenediamine |
| CAS: | 134514-27-5 |
| Molecular Formula: | C6H6 F N3 O2 |
| Molecular Weight: | 171.15 |
| InChI: | InChI=1/C6H6FN3O2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H,8-9H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 181.1°C |
| Boiling Point: | 375.8°C at 760 mmHg |
| Density: | 1.555g/cm3 |
| Refractive index: | 1.673 |
| Specification: |
2-Fluoro-5-nitro-1,4-benzenediamine ,its cas register number is 134514-27-5. It also can be called 1,4-Benzenediamine, 2-fluoro-5-nitro- ; and 4-Amino-3-nitro-6-fluoroaniline . |
| Flash Point: | 181.1°C |
| Safety Data | |
 |
|
