| Identification | |
| Name: | 6-oxo-1,6-dihydropyridine-3-carboxylic acid hydrazide |
| Synonyms: | 1-Methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid hydrazide; 3-Pyridinecarboxylicacid,1,6-dihydro-6-oxo-,hydrazide(9CI) |
| CAS: | 134531-63-8 |
| Molecular Formula: | C6H7N3O2 |
| Molecular Weight: | 153.14 |
| InChI: | InChI=1/C6H7N3O2/c7-9-6(11)4-1-2-5(10)8-3-4/h1-3H,7H2,(H,8,10)(H,9,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.382g/cm3 |
| Refractive index: | 1.591 |
| Specification: |
The 6-Hydroxynicotinoyl hydrazide, with the CAS registry number 134531-63-8, is also known as 6-Oxo-1,6-dihydropyridine-3-carboxylic acid hydrazide. It belongs to the product category of Amide. This chemical's molecular formula is C6H7N3O2 and molecular weight is 153.14. Its systematic name is called 6-oxo-1,6-dihydropyridine-3-carbohydrazide. Physical properties of 6-Hydroxynicotinoyl hydrazide: (1)ACD/LogP: -0.98; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 3; (5)ACD/KOC (pH 7.4): 3; (6)#H bond acceptors: 5; (7)#H bond donors: 4; (8)#Freely Rotating Bonds: 2; (9)Polar Surface Area: 84.22 Å2; (10)Index of Refraction: 1.591; (11)Molar Refractivity: 37.443 cm3; (12)Molar Volume: 110.801 cm3; (13)Surface Tension: 60.303 dyne/cm; (14)Density: 1.382 g/cm3. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
