| Identification | |
| Name: | Pyridine,5-chloro-2-methoxy- |
| Synonyms: | 2-METHOXY-5-CHLORO PYRIDINE; Pyridine, 5-chloro-2-methoxy- |
| CAS: | 13473-01-3 |
| Molecular Formula: | C6H6ClNO |
| Molecular Weight: | 143.57 |
| InChI: | InChI=1/C6H6ClNO/c1-9-6-3-2-5(7)4-8-6/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.193 |
| Refractive index: | 1.5260 |
| Appearance: | Colorless to light yellow liquid |
| Specification: |
5-Chloro-2-methoxypyridine (CAS NO.13473-01-3) is also named as 5-Chloro-2-hydroxypyridine methyl ether ; Pyridine, 5-chloro-2-methoxy- . 5-Chloro-2-methoxypyridine (CAS NO.13473-01-3) is colorless to light yellow liquid. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
